C77H97MnN7O8S4 — CID 21348497
CID 21348497 (PubChem CID 21348497) has the molecular formula C77H97MnN7O8S4 and a molecular weight of 1431.87 g/mol.
| Compound Name | CID 21348497 |
|---|---|
| PubChem CID | 21348497 |
| Molecular Formula | C77H97MnN7O8S4 |
| Molecular Weight | 1431.87 g/mol |
| Exact Mass | 1430.57 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)CCNS(=O)(=O)c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)NCCC(C)(CC)CC)cc4)c4ccc([n-]4)c(-c4ccc(S(=O)(=O)NCCC(C)(CC)CC)cc4)c4nc(c(-c5ccc(S(=O)(=O)NCCC(C)(CC)CC)cc5)c5ccc2[cH-]5)C=C4)C=C3)cc1.[Mn+2] |
| InChI | InChI=1S/C77H97N7O8S4.Mn/c1-13-74(9,14-2)45-49-78-93(85,86)60-31-23-54(24-32-60)70-58-21-22-59(53-58)71(55-25-33-61(34-26-55)94(87,88)79-50-46-75(10,15-3)16-4)65-40-42-67(83-65)73(57-29-37-63(38-30-57)96(91,92)81-52-48-77(12,19-7)20-8)69-44-43-68(84-69)72(66-41-39-64(70)82-66)56-27-35-62(36-28-56)95(89,90)80-51-47-76(11,17-5)18-6;/h21-44,53,78-81H,13-20,45-52H2,1-12H3;/q-2;+2/b70-58-,70-64-,71-59-,71-65-,72-66-,72-68-,73-67-,73-69-; |
| InChIKey | FKCZIVHMLVLURL-AFBRLNQXSA-N |
| XLogP | 17.32 |
| TPSA | 224.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 97 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1431.87 |
| LogP ≤ 5 | 17.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|