C9H13FNO4P — CID 21352219
[fluoro-[5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methyl]-methylphosphinic acid (PubChem CID 21352219) has the molecular formula C9H13FNO4P and a molecular weight of 249.18 g/mol. Its IUPAC name is [fluoro-[5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methyl]-methylphosphinic acid.
| Compound Name | [fluoro-[5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 21352219 |
| Molecular Formula | C9H13FNO4P |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [fluoro-[5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methyl]-methylphosphinic acid |
| SMILES | Cc1ncc(C(F)P(C)(=O)O)c(CO)c1O |
| InChI | InChI=1S/C9H13FNO4P/c1-5-8(13)7(4-12)6(3-11-5)9(10)16(2,14)15/h3,9,12-13H,4H2,1-2H3,(H,14,15) |
| InChIKey | GAFAIAAYVAJVGG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|