C13H20O2S — CID 21353064
1,2,3,4-tetramethyl-5-propylsulfonylbenzene (PubChem CID 21353064) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-5-propylsulfonylbenzene.
| Compound Name | 1,2,3,4-tetramethyl-5-propylsulfonylbenzene |
|---|---|
| PubChem CID | 21353064 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1,2,3,4-tetramethyl-5-propylsulfonylbenzene |
| SMILES | CCCS(=O)(=O)c1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C13H20O2S/c1-6-7-16(14,15)13-8-9(2)10(3)11(4)12(13)5/h8H,6-7H2,1-5H3 |
| InChIKey | FRDWNLRBDNPSQG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |