C13H23N — CID 21354338
2-ethyl-3a,5,7-trimethyl-1,2,3,6,7,7a-hexahydroindole (PubChem CID 21354338) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2-ethyl-3a,5,7-trimethyl-1,2,3,6,7,7a-hexahydroindole.
| Compound Name | 2-ethyl-3a,5,7-trimethyl-1,2,3,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 21354338 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2-ethyl-3a,5,7-trimethyl-1,2,3,6,7,7a-hexahydroindole |
| SMILES | CCC1CC2(C)C=C(C)CC(C)C2N1 |
| InChI | InChI=1S/C13H23N/c1-5-11-8-13(4)7-9(2)6-10(3)12(13)14-11/h7,10-12,14H,5-6,8H2,1-4H3 |
| InChIKey | AFVNNYDMXZOJFN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|