C21H21N5OS2 — CID 21358528
2-N-[4-(dimethylamino)phenyl]-5-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1,3-thiazole-2,4-diamine (PubChem CID 21358528) has the molecular formula C21H21N5OS2 and a molecular weight of 423.57 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)phenyl]-5-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[4-(dimethylamino)phenyl]-5-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 21358528 |
| Molecular Formula | C21H21N5OS2 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-N-[4-(dimethylamino)phenyl]-5-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-1,3-thiazole-2,4-diamine |
| SMILES | COc1ccc(-c2csc(-c3sc(Nc4ccc(N(C)C)cc4)nc3N)n2)cc1 |
| InChI | InChI=1S/C21H21N5OS2/c1-26(2)15-8-6-14(7-9-15)23-21-25-19(22)18(29-21)20-24-17(12-28-20)13-4-10-16(27-3)11-5-13/h4-12H,22H2,1-3H3,(H,23,25) |
| InChIKey | OBYBAGYPZCOUCJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|