C22H27N5O2S — CID 21360586
5-(1H-imidazol-5-ylmethyl)-N,N-dimethyl-1,1-dioxo-2-(2-phenylethyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-7-amine (PubChem CID 21360586) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 5-(1H-imidazol-5-ylmethyl)-N,N-dimethyl-1,1-dioxo-2-(2-phenylethyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-7-amine.
| Compound Name | 5-(1H-imidazol-5-ylmethyl)-N,N-dimethyl-1,1-dioxo-2-(2-phenylethyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-7-amine |
|---|---|
| PubChem CID | 21360586 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 5-(1H-imidazol-5-ylmethyl)-N,N-dimethyl-1,1-dioxo-2-(2-phenylethyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-7-amine |
| SMILES | CN(C)c1ccc2c(c1)N(Cc1cnc[nH]1)CCN(CCc1ccccc1)S2(=O)=O |
| InChI | InChI=1S/C22H27N5O2S/c1-25(2)20-8-9-22-21(14-20)26(16-19-15-23-17-24-19)12-13-27(30(22,28)29)11-10-18-6-4-3-5-7-18/h3-9,14-15,17H,10-13,16H2,1-2H3,(H,23,24) |
| InChIKey | DSSTZWOIQNWWMH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |