C22H26BrN5S — CID 22991988
8-bromo-5-(1H-imidazol-5-ylmethyl)-N,N-dimethyl-2-(2-phenylethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-7-amine (PubChem CID 22991988) has the molecular formula C22H26BrN5S and a molecular weight of 472.46 g/mol. Its IUPAC name is 8-bromo-5-(1H-imidazol-5-ylmethyl)-N,N-dimethyl-2-(2-phenylethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-7-amine.
| Compound Name | 8-bromo-5-(1H-imidazol-5-ylmethyl)-N,N-dimethyl-2-(2-phenylethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-7-amine |
|---|---|
| PubChem CID | 22991988 |
| Molecular Formula | C22H26BrN5S |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 8-bromo-5-(1H-imidazol-5-ylmethyl)-N,N-dimethyl-2-(2-phenylethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-7-amine |
| SMILES | CN(C)c1cc2c(cc1Br)SN(CCc1ccccc1)CCN2Cc1cnc[nH]1 |
| InChI | InChI=1S/C22H26BrN5S/c1-26(2)20-13-21-22(12-19(20)23)29-28(9-8-17-6-4-3-5-7-17)11-10-27(21)15-18-14-24-16-25-18/h3-7,12-14,16H,8-11,15H2,1-2H3,(H,24,25) |
| InChIKey | NLGBGQICXHKWEY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|