C23H26N4O2S — CID 21360593
5-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-4,7,8,9-tetrahydro-3H-cyclopenta[h][1,2,5]benzothiadiazepine 1,1-dioxide (PubChem CID 21360593) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 5-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-4,7,8,9-tetrahydro-3H-cyclopenta[h][1,2,5]benzothiadiazepine 1,1-dioxide.
| Compound Name | 5-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-4,7,8,9-tetrahydro-3H-cyclopenta[h][1,2,5]benzothiadiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 21360593 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 5-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-4,7,8,9-tetrahydro-3H-cyclopenta[h][1,2,5]benzothiadiazepine 1,1-dioxide |
| SMILES | O=S1(=O)c2cc3c(cc2N(Cc2cnc[nH]2)CCN1CCc1ccccc1)CCC3 |
| InChI | InChI=1S/C23H26N4O2S/c28-30(29)23-14-20-8-4-7-19(20)13-22(23)26(16-21-15-24-17-25-21)11-12-27(30)10-9-18-5-2-1-3-6-18/h1-3,5-6,13-15,17H,4,7-12,16H2,(H,24,25) |
| InChIKey | JGDSNEDFYLGMSV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |