C27H33N5OS — CID 54226431
N-[5-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-3-yl]cyclohexanecarboxamide (PubChem CID 54226431) has the molecular formula C27H33N5OS and a molecular weight of 475.66 g/mol. Its IUPAC name is N-[5-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[5-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 54226431 |
| Molecular Formula | C27H33N5OS |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-[5-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(NC1CN(Cc2cnc[nH]2)c2ccccc2SN1CCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C27H33N5OS/c33-27(22-11-5-2-6-12-22)30-26-19-31(18-23-17-28-20-29-23)24-13-7-8-14-25(24)34-32(26)16-15-21-9-3-1-4-10-21/h1,3-4,7-10,13-14,17,20,22,26H,2,5-6,11-12,15-16,18-19H2,(H,28,29)(H,30,33) |
| InChIKey | QGENHASACPXETJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|