C20H20N4S — CID 70197636
3-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-3H-1,2,5-benzothiadiazepine (PubChem CID 70197636) has the molecular formula C20H20N4S and a molecular weight of 348.48 g/mol. Its IUPAC name is 3-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-3H-1,2,5-benzothiadiazepine.
| Compound Name | 3-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-3H-1,2,5-benzothiadiazepine |
|---|---|
| PubChem CID | 70197636 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-(1H-imidazol-5-ylmethyl)-2-(2-phenylethyl)-3H-1,2,5-benzothiadiazepine |
| SMILES | C1=Nc2ccccc2SN(CCc2ccccc2)C1Cc1cnc[nH]1 |
| InChI | InChI=1S/C20H20N4S/c1-2-6-16(7-3-1)10-11-24-18(12-17-13-21-15-23-17)14-22-19-8-4-5-9-20(19)25-24/h1-9,13-15,18H,10-12H2,(H,21,23) |
| InChIKey | RIWRLSRLIYFIRR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|