C14H18F6O2 — CID 21362176
5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 21362176) has the molecular formula C14H18F6O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is 5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 21362176 |
| Molecular Formula | C14H18F6O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | CCOCOC(CC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H18F6O2/c1-2-21-8-22-12(13(15,16)17,14(18,19)20)7-11-6-9-3-4-10(11)5-9/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | STBRWZKKBCINRN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|