C29H30O9 — CID 21362377
[6-[5-[(E)-3-(1-benzofuran-5-yl)prop-2-enoyl]-2-methyl-4-prop-2-enoxyphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 21362377) has the molecular formula C29H30O9 and a molecular weight of 522.55 g/mol. Its IUPAC name is [6-[5-[(E)-3-(1-benzofuran-5-yl)prop-2-enoyl]-2-methyl-4-prop-2-enoxyphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [6-[5-[(E)-3-(1-benzofuran-5-yl)prop-2-enoyl]-2-methyl-4-prop-2-enoxyphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 21362377 |
| Molecular Formula | C29H30O9 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | [6-[5-[(E)-3-(1-benzofuran-5-yl)prop-2-enoyl]-2-methyl-4-prop-2-enoxyphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | C=CCOc1cc(C)c(C2OC(COC(C)=O)C(O)C(O)C2O)cc1C(=O)/C=C/c1ccc2occc2c1 |
| InChI | InChI=1S/C29H30O9/c1-4-10-35-24-12-16(2)20(29-28(34)27(33)26(32)25(38-29)15-37-17(3)30)14-21(24)22(31)7-5-18-6-8-23-19(13-18)9-11-36-23/h4-9,11-14,25-29,32-34H,1,10,15H2,2-3H3/b7-5+ |
| InChIKey | UTZSMEZOVFZWNG-FNORWQNLSA-N |
| XLogP | 3.29 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|