C28H52OSi — CID 21365321
1-[1-pentyl-4-(4-pentylcyclohexyl)cyclohexyl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 21365321) has the molecular formula C28H52OSi and a molecular weight of 432.81 g/mol. Its IUPAC name is 1-[1-pentyl-4-(4-pentylcyclohexyl)cyclohexyl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | 1-[1-pentyl-4-(4-pentylcyclohexyl)cyclohexyl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 21365321 |
| Molecular Formula | C28H52OSi |
| Molecular Weight | 432.81 g/mol |
| Exact Mass | 432.38 |
| IUPAC Name | 1-[1-pentyl-4-(4-pentylcyclohexyl)cyclohexyl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | CCCCCC1CCC(C2CCC(CCCCC)(C(O)C#C[Si](C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C28H52OSi/c1-6-8-10-12-24-13-15-25(16-14-24)26-17-21-28(22-18-26,20-11-9-7-2)27(29)19-23-30(3,4)5/h24-27,29H,6-18,20-22H2,1-5H3 |
| InChIKey | BHEYKCRGEIRFPV-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.81 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|