C26H44O2 — CID 21365323
1-[4-(4-methylcyclohexyl)-1-[(4-methylcyclohexyl)methyl]cyclohexyl]pent-2-yne-1,4-diol (PubChem CID 21365323) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is 1-[4-(4-methylcyclohexyl)-1-[(4-methylcyclohexyl)methyl]cyclohexyl]pent-2-yne-1,4-diol.
| Compound Name | 1-[4-(4-methylcyclohexyl)-1-[(4-methylcyclohexyl)methyl]cyclohexyl]pent-2-yne-1,4-diol |
|---|---|
| PubChem CID | 21365323 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 1-[4-(4-methylcyclohexyl)-1-[(4-methylcyclohexyl)methyl]cyclohexyl]pent-2-yne-1,4-diol |
| SMILES | CC(O)C#CC(O)C1(CC2CCC(C)CC2)CCC(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C26H44O2/c1-19-4-9-22(10-5-19)18-26(25(28)13-8-21(3)27)16-14-24(15-17-26)23-11-6-20(2)7-12-23/h19-25,27-28H,4-7,9-12,14-18H2,1-3H3 |
| InChIKey | GXJBPLGETIPPDK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|