C22H24N4O2S — CID 21380992
1-ethyl-3-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]indole (PubChem CID 21380992) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-ethyl-3-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]indole.
| Compound Name | 1-ethyl-3-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]indole |
|---|---|
| PubChem CID | 21380992 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-ethyl-3-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]indole |
| SMILES | CCn1cc(-c2nnc(SCCOc3ccc(OC)cc3)n2C)c2ccccc21 |
| InChI | InChI=1S/C22H24N4O2S/c1-4-26-15-19(18-7-5-6-8-20(18)26)21-23-24-22(25(21)2)29-14-13-28-17-11-9-16(27-3)10-12-17/h5-12,15H,4,13-14H2,1-3H3 |
| InChIKey | XSGYPZFNACLEOE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|