C22H24N4OS — CID 21381047
1-ethyl-3-[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]indole (PubChem CID 21381047) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-ethyl-3-[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]indole.
| Compound Name | 1-ethyl-3-[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]indole |
|---|---|
| PubChem CID | 21381047 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-ethyl-3-[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]indole |
| SMILES | CCn1c(SCCOc2ccccc2)nnc1-c1cn(CC)c2ccccc12 |
| InChI | InChI=1S/C22H24N4OS/c1-3-25-16-19(18-12-8-9-13-20(18)25)21-23-24-22(26(21)4-2)28-15-14-27-17-10-6-5-7-11-17/h5-13,16H,3-4,14-15H2,1-2H3 |
| InChIKey | KZEPBMHYMRLGFA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|