C26H32N4OS — CID 21381053
1-ethyl-3-[4-ethyl-5-[2-(5-methyl-2-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]indole (PubChem CID 21381053) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is 1-ethyl-3-[4-ethyl-5-[2-(5-methyl-2-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]indole.
| Compound Name | 1-ethyl-3-[4-ethyl-5-[2-(5-methyl-2-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]indole |
|---|---|
| PubChem CID | 21381053 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-ethyl-3-[4-ethyl-5-[2-(5-methyl-2-propan-2-ylphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]indole |
| SMILES | CCn1c(SCCOc2cc(C)ccc2C(C)C)nnc1-c1cn(CC)c2ccccc12 |
| InChI | InChI=1S/C26H32N4OS/c1-6-29-17-22(21-10-8-9-11-23(21)29)25-27-28-26(30(25)7-2)32-15-14-31-24-16-19(5)12-13-20(24)18(3)4/h8-13,16-18H,6-7,14-15H2,1-5H3 |
| InChIKey | FEUJOBXGBBANEJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|