C18H15ClN2O4 — CID 21383160
3-[5-(4-chlorophenyl)-1-(furan-2-carbonylamino)pyrrol-2-yl]propanoic acid (PubChem CID 21383160) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1-(furan-2-carbonylamino)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[5-(4-chlorophenyl)-1-(furan-2-carbonylamino)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 21383160 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1-(furan-2-carbonylamino)pyrrol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2ccc(Cl)cc2)n1NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H15ClN2O4/c19-13-5-3-12(4-6-13)15-9-7-14(8-10-17(22)23)21(15)20-18(24)16-2-1-11-25-16/h1-7,9,11H,8,10H2,(H,20,24)(H,22,23) |
| InChIKey | ZPQPQRSSBZGMKH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |