C20H16Cl2N2O3 — CID 1255522
3-[1-[(2,4-dichlorobenzoyl)amino]-5-phenylpyrrol-2-yl]propanoic acid (PubChem CID 1255522) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is 3-[1-[(2,4-dichlorobenzoyl)amino]-5-phenylpyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-[(2,4-dichlorobenzoyl)amino]-5-phenylpyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 1255522 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 3-[1-[(2,4-dichlorobenzoyl)amino]-5-phenylpyrrol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2ccccc2)n1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N2O3/c21-14-6-9-16(17(22)12-14)20(27)23-24-15(8-11-19(25)26)7-10-18(24)13-4-2-1-3-5-13/h1-7,9-10,12H,8,11H2,(H,23,27)(H,25,26) |
| InChIKey | DBVJEENQMOBKRS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |