C23H17ClN2O — CID 134096030
4-chloro-N-(2,5-diphenylpyrrol-1-yl)benzamide (PubChem CID 134096030) has the molecular formula C23H17ClN2O and a molecular weight of 372.86 g/mol. Its IUPAC name is 4-chloro-N-(2,5-diphenylpyrrol-1-yl)benzamide.
| Compound Name | 4-chloro-N-(2,5-diphenylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 134096030 |
| Molecular Formula | C23H17ClN2O |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-chloro-N-(2,5-diphenylpyrrol-1-yl)benzamide |
| SMILES | O=C(Nn1c(-c2ccccc2)ccc1-c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN2O/c24-20-13-11-19(12-14-20)23(27)25-26-21(17-7-3-1-4-8-17)15-16-22(26)18-9-5-2-6-10-18/h1-16H,(H,25,27) |
| InChIKey | RWWUUUQYAQEHQU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |