C15H14ClNO — CID 21388068
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methylprop-2-yn-1-amine (PubChem CID 21388068) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methylprop-2-yn-1-amine.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 21388068 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-N-methylprop-2-yn-1-amine |
| SMILES | C#CCN(C)Cc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C15H14ClNO/c1-3-10-17(2)11-14-8-9-15(18-14)12-4-6-13(16)7-5-12/h1,4-9H,10-11H2,2H3 |
| InChIKey | DZMBBLAFOYMOKF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|