C18H18ClN3O — CID 32526863
(2R)-2-[[[5-(4-chlorophenyl)furan-2-yl]methyl-methylamino]methyl]pentanedinitrile (PubChem CID 32526863) has the molecular formula C18H18ClN3O and a molecular weight of 327.81 g/mol. Its IUPAC name is (2R)-2-[[[5-(4-chlorophenyl)furan-2-yl]methyl-methylamino]methyl]pentanedinitrile.
| Compound Name | (2R)-2-[[[5-(4-chlorophenyl)furan-2-yl]methyl-methylamino]methyl]pentanedinitrile |
|---|---|
| PubChem CID | 32526863 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (2R)-2-[[[5-(4-chlorophenyl)furan-2-yl]methyl-methylamino]methyl]pentanedinitrile |
| SMILES | CN(Cc1ccc(-c2ccc(Cl)cc2)o1)C[C@H](C#N)CCC#N |
| InChI | InChI=1S/C18H18ClN3O/c1-22(12-14(11-21)3-2-10-20)13-17-8-9-18(23-17)15-4-6-16(19)7-5-15/h4-9,14H,2-3,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | QFWFUSDQZSTXQQ-AWEZNQCLSA-N |
| XLogP | 4.48 |
| TPSA | 63.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |