C27H27Cl2NO2 — CID 21413431
N,N-bis[[5-(4-chlorophenyl)furan-2-yl]methyl]pentan-1-amine (PubChem CID 21413431) has the molecular formula C27H27Cl2NO2 and a molecular weight of 468.42 g/mol. Its IUPAC name is N,N-bis[[5-(4-chlorophenyl)furan-2-yl]methyl]pentan-1-amine.
| Compound Name | N,N-bis[[5-(4-chlorophenyl)furan-2-yl]methyl]pentan-1-amine |
|---|---|
| PubChem CID | 21413431 |
| Molecular Formula | C27H27Cl2NO2 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N,N-bis[[5-(4-chlorophenyl)furan-2-yl]methyl]pentan-1-amine |
| SMILES | CCCCCN(Cc1ccc(-c2ccc(Cl)cc2)o1)Cc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C27H27Cl2NO2/c1-2-3-4-17-30(18-24-13-15-26(31-24)20-5-9-22(28)10-6-20)19-25-14-16-27(32-25)21-7-11-23(29)12-8-21/h5-16H,2-4,17-19H2,1H3 |
| InChIKey | XDEAUSXZYHHPHG-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|