C8H12N4O2 — CID 21388289
1-piperazin-1-ylpyrimidine-2,4-dione (PubChem CID 21388289) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-piperazin-1-ylpyrimidine-2,4-dione.
| Compound Name | 1-piperazin-1-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21388289 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-piperazin-1-ylpyrimidine-2,4-dione |
| SMILES | O=c1ccn(N2CCNCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N4O2/c13-7-1-4-12(8(14)10-7)11-5-2-9-3-6-11/h1,4,9H,2-3,5-6H2,(H,10,13,14) |
| InChIKey | JQBZKZYTCHXKDU-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |