C21H19N2O7P — CID 21388352
2-(diphenoxyphosphorylcarbamoylamino)-2-(4-hydroxyphenyl)acetic acid (PubChem CID 21388352) has the molecular formula C21H19N2O7P and a molecular weight of 442.36 g/mol. Its IUPAC name is 2-(diphenoxyphosphorylcarbamoylamino)-2-(4-hydroxyphenyl)acetic acid.
| Compound Name | 2-(diphenoxyphosphorylcarbamoylamino)-2-(4-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 21388352 |
| Molecular Formula | C21H19N2O7P |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-(diphenoxyphosphorylcarbamoylamino)-2-(4-hydroxyphenyl)acetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccc(O)cc1)NP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C21H19N2O7P/c24-16-13-11-15(12-14-16)19(20(25)26)22-21(27)23-31(28,29-17-7-3-1-4-8-17)30-18-9-5-2-6-10-18/h1-14,19,24H,(H,25,26)(H2,22,23,27,28) |
| InChIKey | LUAYXZGPAQIMTI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|