C20H42NO4+ — CID 21393069
2-carboxyethyl-[4-(2,3-dihydroxypropyl)dodecyl]-dimethylazanium (PubChem CID 21393069) has the molecular formula C20H42NO4+ and a molecular weight of 360.56 g/mol. Its IUPAC name is 2-carboxyethyl-[4-(2,3-dihydroxypropyl)dodecyl]-dimethylazanium.
| Compound Name | 2-carboxyethyl-[4-(2,3-dihydroxypropyl)dodecyl]-dimethylazanium |
|---|---|
| PubChem CID | 21393069 |
| Molecular Formula | C20H42NO4+ |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | 2-carboxyethyl-[4-(2,3-dihydroxypropyl)dodecyl]-dimethylazanium |
| SMILES | CCCCCCCCC(CCC[N+](C)(C)CCC(=O)O)CC(O)CO |
| InChI | InChI=1S/C20H41NO4/c1-4-5-6-7-8-9-11-18(16-19(23)17-22)12-10-14-21(2,3)15-13-20(24)25/h18-19,22-23H,4-17H2,1-3H3/p+1 |
| InChIKey | BYGKBKWDDMHYCU-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|