C14H24O4 — CID 21397290
2-methoxy-4-octyl-3,7-dioxabicyclo[4.1.0]heptan-5-one (PubChem CID 21397290) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-methoxy-4-octyl-3,7-dioxabicyclo[4.1.0]heptan-5-one.
| Compound Name | 2-methoxy-4-octyl-3,7-dioxabicyclo[4.1.0]heptan-5-one |
|---|---|
| PubChem CID | 21397290 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-methoxy-4-octyl-3,7-dioxabicyclo[4.1.0]heptan-5-one |
| SMILES | CCCCCCCCC1OC(OC)C2OC2C1=O |
| InChI | InChI=1S/C14H24O4/c1-3-4-5-6-7-8-9-10-11(15)12-13(18-12)14(16-2)17-10/h10,12-14H,3-9H2,1-2H3 |
| InChIKey | BYIAIFISPQYESO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|