C29H31ClN4O6 — CID 21398332
[2-[[3-[(2-acetyloxybenzoyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl] acetate;hydrochloride (PubChem CID 21398332) has the molecular formula C29H31ClN4O6 and a molecular weight of 567.04 g/mol. Its IUPAC name is [2-[[3-[(2-acetyloxybenzoyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl] acetate;hydrochloride.
| Compound Name | [2-[[3-[(2-acetyloxybenzoyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 21398332 |
| Molecular Formula | C29H31ClN4O6 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [2-[[3-[(2-acetyloxybenzoyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1ccc(N2CCN(C)CC2)c(NC(=O)c2ccccc2OC(C)=O)c1.Cl |
| InChI | InChI=1S/C29H30N4O6.ClH/c1-19(34)38-26-10-6-4-8-22(26)28(36)30-21-12-13-25(33-16-14-32(3)15-17-33)24(18-21)31-29(37)23-9-5-7-11-27(23)39-20(2)35;/h4-13,18H,14-17H2,1-3H3,(H,30,36)(H,31,37);1H |
| InChIKey | OZUSTLIRTHASHD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|