About 3-methyl-4-sulfonylhexa-1,5-diene
3-methyl-4-sulfonylhexa-1,5-diene (PubChem CID 21400124) has the molecular formula C7H10O2S
and a molecular weight of 158.22 g/mol. Its IUPAC name is 3-methyl-4-sulfonylhexa-1,5-diene.
Molecular Properties
| Compound Name | 3-methyl-4-sulfonylhexa-1,5-diene |
| PubChem CID | 21400124 |
| Molecular Formula | C7H10O2S |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 3-methyl-4-sulfonylhexa-1,5-diene |
| SMILES | C=CC(C(C)C=C)=S(=O)=O |
| InChI | InChI=1S/C7H10O2S/c1-4-6(3)7(5-2)10(8)9/h4-6H,1-2H2,3H3 |
| InChIKey | NLZYSATUYXNFIG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-sulfonylhexa-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-sulfonylhexa-1,5-diene?
The IUPAC name of 3-methyl-4-sulfonylhexa-1,5-diene (CID 21400124) is 3-methyl-4-sulfonylhexa-1,5-diene.
What is the SMILES notation for 3-methyl-4-sulfonylhexa-1,5-diene?
The canonical SMILES for 3-methyl-4-sulfonylhexa-1,5-diene is C=CC(C(C)C=C)=S(=O)=O.
What is the InChIKey of 3-methyl-4-sulfonylhexa-1,5-diene?
The InChIKey is NLZYSATUYXNFIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2S/c1-4-6(3)7(5-2)10(8)9/h4-6H,1-2H2,3H3.
What are the key properties of 3-methyl-4-sulfonylhexa-1,5-diene?
3-methyl-4-sulfonylhexa-1,5-diene has a molecular weight of 158.22 g/mol, XLogP of 1.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-sulfonylhexa-1,5-diene is sourced from PubChem (CID 21400124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).