C16H26O2 — CID 177343781
(4S,9S)-9-methyl-4-(2-methylpropyl)undeca-1,10-diene-3,8-dione (PubChem CID 177343781) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (4S,9S)-9-methyl-4-(2-methylpropyl)undeca-1,10-diene-3,8-dione.
| Compound Name | (4S,9S)-9-methyl-4-(2-methylpropyl)undeca-1,10-diene-3,8-dione |
|---|---|
| PubChem CID | 177343781 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (4S,9S)-9-methyl-4-(2-methylpropyl)undeca-1,10-diene-3,8-dione |
| SMILES | C=CC(=O)[C@@H](CCCC(=O)[C@@H](C)C=C)CC(C)C |
| InChI | InChI=1S/C16H26O2/c1-6-13(5)16(18)10-8-9-14(11-12(3)4)15(17)7-2/h6-7,12-14H,1-2,8-11H2,3-5H3/t13-,14-/m0/s1 |
| InChIKey | QWUMYCXIJLNYDM-KBPBESRZSA-N |
| XLogP | 3.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|