About 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate
1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate (PubChem CID 21400628) has the molecular formula C7H11N3S3
and a molecular weight of 233.39 g/mol. Its IUPAC name is 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate.
Molecular Properties
| Compound Name | 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate |
| PubChem CID | 21400628 |
| Molecular Formula | C7H11N3S3 |
| Molecular Weight | 233.39 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate |
| SMILES | CC(SCc1ncc[nH]1)SC(N)=S |
| InChI | InChI=1S/C7H11N3S3/c1-5(13-7(8)11)12-4-6-9-2-3-10-6/h2-3,5H,4H2,1H3,(H2,8,11)(H,9,10) |
| InChIKey | QTNOTASWOAPDPQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate?
The IUPAC name of 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate (CID 21400628) is 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate.
What is the SMILES notation for 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate?
The canonical SMILES for 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate is CC(SCc1ncc[nH]1)SC(N)=S.
What is the InChIKey of 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate?
The InChIKey is QTNOTASWOAPDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S3/c1-5(13-7(8)11)12-4-6-9-2-3-10-6/h2-3,5H,4H2,1H3,(H2,8,11)(H,9,10).
What are the key properties of 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate?
1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate has a molecular weight of 233.39 g/mol, XLogP of 1.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-2-ylmethylsulfanyl)ethyl carbamodithioate is sourced from PubChem (CID 21400628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).