C7H12N4S2 — CID 22765373
2-(1H-imidazol-2-ylmethylsulfanyl)ethylthiourea (PubChem CID 22765373) has the molecular formula C7H12N4S2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(1H-imidazol-2-ylmethylsulfanyl)ethylthiourea.
| Compound Name | 2-(1H-imidazol-2-ylmethylsulfanyl)ethylthiourea |
|---|---|
| PubChem CID | 22765373 |
| Molecular Formula | C7H12N4S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-(1H-imidazol-2-ylmethylsulfanyl)ethylthiourea |
| SMILES | NC(=S)NCCSCc1ncc[nH]1 |
| InChI | InChI=1S/C7H12N4S2/c8-7(12)11-3-4-13-5-6-9-1-2-10-6/h1-2H,3-5H2,(H,9,10)(H3,8,11,12) |
| InChIKey | BVMSENKHYPMMEF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|