C6H15N3O — CID 21404115
N,N'-diethyl-1-nitrosoethane-1,2-diamine (PubChem CID 21404115) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is N,N'-diethyl-1-nitrosoethane-1,2-diamine.
| Compound Name | N,N'-diethyl-1-nitrosoethane-1,2-diamine |
|---|---|
| PubChem CID | 21404115 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | N,N'-diethyl-1-nitrosoethane-1,2-diamine |
| SMILES | CCNCC(N=O)NCC |
| InChI | InChI=1S/C6H15N3O/c1-3-7-5-6(9-10)8-4-2/h6-8H,3-5H2,1-2H3 |
| InChIKey | CMHDLDAWZFKUMJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |