C19H21N — CID 21412165
N-cyclohexyl-1,1-diphenylmethanimine (PubChem CID 21412165) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is N-cyclohexyl-1,1-diphenylmethanimine.
| Compound Name | N-cyclohexyl-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 21412165 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-cyclohexyl-1,1-diphenylmethanimine |
| SMILES | c1ccc(C(=NC2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2 |
| InChIKey | SZOLXYOCCOZLNF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|