C10H14O4Pd+2 — CID 21417779
3,3-diacetylhexane-2,5-dione;palladium(2+) (PubChem CID 21417779) has the molecular formula C10H14O4Pd+2 and a molecular weight of 304.64 g/mol. Its IUPAC name is 3,3-diacetylhexane-2,5-dione;palladium(2+).
| Compound Name | 3,3-diacetylhexane-2,5-dione;palladium(2+) |
|---|---|
| PubChem CID | 21417779 |
| Molecular Formula | C10H14O4Pd+2 |
| Molecular Weight | 304.64 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 3,3-diacetylhexane-2,5-dione;palladium(2+) |
| SMILES | CC(=O)CC(C(C)=O)(C(C)=O)C(C)=O.[Pd+2] |
| InChI | InChI=1S/C10H14O4.Pd/c1-6(11)5-10(7(2)12,8(3)13)9(4)14;/h5H2,1-4H3;/q;+2 |
| InChIKey | YVTLGLIKCRAXOM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.64 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|