C20H22Cl2N6O — CID 21419482
1,2-bis[(E)-(4-chlorophenyl)methylideneamino]guanidine;1-methylpyrrolidin-2-one (PubChem CID 21419482) has the molecular formula C20H22Cl2N6O and a molecular weight of 433.34 g/mol. Its IUPAC name is 1,2-bis[(E)-(4-chlorophenyl)methylideneamino]guanidine;1-methylpyrrolidin-2-one.
| Compound Name | 1,2-bis[(E)-(4-chlorophenyl)methylideneamino]guanidine;1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 21419482 |
| Molecular Formula | C20H22Cl2N6O |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1,2-bis[(E)-(4-chlorophenyl)methylideneamino]guanidine;1-methylpyrrolidin-2-one |
| SMILES | CN1CCCC1=O.N/C(=N/N=C/c1ccc(Cl)cc1)N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2N5.C5H9NO/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12;1-6-4-2-3-5(6)7/h1-10H,(H3,18,21,22);2-4H2,1H3/b19-9+,20-10+; |
| InChIKey | NZOYVZKEEHXZFX-HCURTGQUSA-N |
| XLogP | 3.50 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|