C16H17Cl2NO — CID 21421143
5-[4-(3,4-dichlorophenyl)butyl]-1,3-dihydrofuro[3,4-c]pyrrole (PubChem CID 21421143) has the molecular formula C16H17Cl2NO and a molecular weight of 310.22 g/mol. Its IUPAC name is 5-[4-(3,4-dichlorophenyl)butyl]-1,3-dihydrofuro[3,4-c]pyrrole.
| Compound Name | 5-[4-(3,4-dichlorophenyl)butyl]-1,3-dihydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 21421143 |
| Molecular Formula | C16H17Cl2NO |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-[4-(3,4-dichlorophenyl)butyl]-1,3-dihydrofuro[3,4-c]pyrrole |
| SMILES | Clc1ccc(CCCCn2cc3c(c2)COC3)cc1Cl |
| InChI | InChI=1S/C16H17Cl2NO/c17-15-5-4-12(7-16(15)18)3-1-2-6-19-8-13-10-20-11-14(13)9-19/h4-5,7-9H,1-3,6,10-11H2 |
| InChIKey | HANSFAMTJXYAAL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|