C17H26Cl2O2S — CID 21423824
1-[(2,4-dichlorophenyl)methylsulfanyl]-3-heptoxypropan-2-ol (PubChem CID 21423824) has the molecular formula C17H26Cl2O2S and a molecular weight of 365.37 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methylsulfanyl]-3-heptoxypropan-2-ol.
| Compound Name | 1-[(2,4-dichlorophenyl)methylsulfanyl]-3-heptoxypropan-2-ol |
|---|---|
| PubChem CID | 21423824 |
| Molecular Formula | C17H26Cl2O2S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methylsulfanyl]-3-heptoxypropan-2-ol |
| SMILES | CCCCCCCOCC(O)CSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H26Cl2O2S/c1-2-3-4-5-6-9-21-11-16(20)13-22-12-14-7-8-15(18)10-17(14)19/h7-8,10,16,20H,2-6,9,11-13H2,1H3 |
| InChIKey | PSDSFRQAJUDEPQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|