C18H22N2O — CID 21425305
4-methyl-4-(piperidin-1-ylmethyl)pyrrolo[2,1-c][1,4]benzoxazine (PubChem CID 21425305) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-methyl-4-(piperidin-1-ylmethyl)pyrrolo[2,1-c][1,4]benzoxazine.
| Compound Name | 4-methyl-4-(piperidin-1-ylmethyl)pyrrolo[2,1-c][1,4]benzoxazine |
|---|---|
| PubChem CID | 21425305 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-methyl-4-(piperidin-1-ylmethyl)pyrrolo[2,1-c][1,4]benzoxazine |
| SMILES | CC1(CN2CCCCC2)Oc2ccccc2-n2cccc21 |
| InChI | InChI=1S/C18H22N2O/c1-18(14-19-11-5-2-6-12-19)17-10-7-13-20(17)15-8-3-4-9-16(15)21-18/h3-4,7-10,13H,2,5-6,11-12,14H2,1H3 |
| InChIKey | ODYOCQNAXMDMSF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |