C28H30ClN3O4 — CID 21425561
2-[1-(1H-indol-3-yl)propan-2-ylamino]-5-nitro-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-ol;hydrochloride (PubChem CID 21425561) has the molecular formula C28H30ClN3O4 and a molecular weight of 508.02 g/mol. Its IUPAC name is 2-[1-(1H-indol-3-yl)propan-2-ylamino]-5-nitro-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-ol;hydrochloride.
| Compound Name | 2-[1-(1H-indol-3-yl)propan-2-ylamino]-5-nitro-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-ol;hydrochloride |
|---|---|
| PubChem CID | 21425561 |
| Molecular Formula | C28H30ClN3O4 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[1-(1H-indol-3-yl)propan-2-ylamino]-5-nitro-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-ol;hydrochloride |
| SMILES | CC(Cc1c[nH]c2ccccc12)NC1CCc2c(ccc(OCc3ccccc3)c2[N+](=O)[O-])C1O.Cl |
| InChI | InChI=1S/C28H29N3O4.ClH/c1-18(15-20-16-29-24-10-6-5-9-21(20)24)30-25-13-11-22-23(28(25)32)12-14-26(27(22)31(33)34)35-17-19-7-3-2-4-8-19;/h2-10,12,14,16,18,25,28-30,32H,11,13,15,17H2,1H3;1H |
| InChIKey | KOFHOYUJSIDSKT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|