C7H12N4 — CID 21436319
4-ethylpyridine-2,3,5-triamine (PubChem CID 21436319) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-ethylpyridine-2,3,5-triamine.
| Compound Name | 4-ethylpyridine-2,3,5-triamine |
|---|---|
| PubChem CID | 21436319 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-ethylpyridine-2,3,5-triamine |
| SMILES | CCc1c(N)cnc(N)c1N |
| InChI | InChI=1S/C7H12N4/c1-2-4-5(8)3-11-7(10)6(4)9/h3H,2,8-9H2,1H3,(H2,10,11) |
| InChIKey | YOZJTYFGTFMCFS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |