About 4-propylpyridazine-3,5-diamine
4-propylpyridazine-3,5-diamine (PubChem CID 174928116) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-propylpyridazine-3,5-diamine.
Molecular Properties
| Compound Name | 4-propylpyridazine-3,5-diamine |
| PubChem CID | 174928116 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-propylpyridazine-3,5-diamine |
| SMILES | CCCc1c(N)cnnc1N |
| InChI | InChI=1S/C7H12N4/c1-2-3-5-6(8)4-10-11-7(5)9/h4H,2-3H2,1H3,(H4,8,9,11) |
| InChIKey | PRBOASZOQXPVLZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-propylpyridazine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylpyridazine-3,5-diamine?
The IUPAC name of 4-propylpyridazine-3,5-diamine (CID 174928116) is 4-propylpyridazine-3,5-diamine.
What is the SMILES notation for 4-propylpyridazine-3,5-diamine?
The canonical SMILES for 4-propylpyridazine-3,5-diamine is CCCc1c(N)cnnc1N.
What is the InChIKey of 4-propylpyridazine-3,5-diamine?
The InChIKey is PRBOASZOQXPVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-2-3-5-6(8)4-10-11-7(5)9/h4H,2-3H2,1H3,(H4,8,9,11).
What are the key properties of 4-propylpyridazine-3,5-diamine?
4-propylpyridazine-3,5-diamine has a molecular weight of 152.20 g/mol, XLogP of 0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylpyridazine-3,5-diamine is sourced from PubChem (CID 174928116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).