C7H12N4 — CID 174928116
4-propylpyridazine-3,5-diamine (PubChem CID 174928116) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-propylpyridazine-3,5-diamine.
| Compound Name | 4-propylpyridazine-3,5-diamine |
|---|---|
| PubChem CID | 174928116 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-propylpyridazine-3,5-diamine |
| SMILES | CCCc1c(N)cnnc1N |
| InChI | InChI=1S/C7H12N4/c1-2-3-5-6(8)4-10-11-7(5)9/h4H,2-3H2,1H3,(H4,8,9,11) |
| InChIKey | PRBOASZOQXPVLZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |