About [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride
[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride (PubChem CID 21438427) has the molecular formula C24H29ClFNO4
and a molecular weight of 449.95 g/mol. Its IUPAC name is [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride.
Molecular Properties
| Compound Name | [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride |
| PubChem CID | 21438427 |
| Molecular Formula | C24H29ClFNO4 |
| Molecular Weight | 449.95 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride |
| SMILES | Cc1ccc(C(=O)OC2(O)CCN(CCCC(=O)c3ccc(F)cc3)CC2)cc1C.Cl |
| InChI | InChI=1S/C24H28FNO4.ClH/c1-17-5-6-20(16-18(17)2)23(28)30-24(29)11-14-26(15-12-24)13-3-4-22(27)19-7-9-21(25)10-8-19;/h5-10,16,29H,3-4,11-15H2,1-2H3;1H |
| InChIKey | RIYUUDHQEWTCHF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.95 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride?
The IUPAC name of [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride (CID 21438427) is [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride.
What is the SMILES notation for [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride?
The canonical SMILES for [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride is Cc1ccc(C(=O)OC2(O)CCN(CCCC(=O)c3ccc(F)cc3)CC2)cc1C.Cl.
What is the InChIKey of [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride?
The InChIKey is RIYUUDHQEWTCHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28FNO4.ClH/c1-17-5-6-20(16-18(17)2)23(28)30-24(29)11-14-26(15-12-24)13-3-4-22(27)19-7-9-21(25)10-8-19;/h5-10,16,29H,3-4,11-15H2,1-2H3;1H.
What are the key properties of [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride?
[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride has a molecular weight of 449.95 g/mol, XLogP of 4.47, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride is sourced from PubChem (CID 21438427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).