C24H29ClFNO4 — CID 21438427
[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride (PubChem CID 21438427) has the molecular formula C24H29ClFNO4 and a molecular weight of 449.95 g/mol. Its IUPAC name is [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride.
| Compound Name | [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 21438427 |
| Molecular Formula | C24H29ClFNO4 |
| Molecular Weight | 449.95 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [1-[4-(4-fluorophenyl)-4-oxobutyl]-4-hydroxypiperidin-4-yl] 3,4-dimethylbenzoate;hydrochloride |
| SMILES | Cc1ccc(C(=O)OC2(O)CCN(CCCC(=O)c3ccc(F)cc3)CC2)cc1C.Cl |
| InChI | InChI=1S/C24H28FNO4.ClH/c1-17-5-6-20(16-18(17)2)23(28)30-24(29)11-14-26(15-12-24)13-3-4-22(27)19-7-9-21(25)10-8-19;/h5-10,16,29H,3-4,11-15H2,1-2H3;1H |
| InChIKey | RIYUUDHQEWTCHF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.95 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|