C14H26N4O3S — CID 21442020
butyl N-(tert-butylsulfanylcarbamoyl)-N-(prop-2-enylcarbamoyl)carbamimidate (PubChem CID 21442020) has the molecular formula C14H26N4O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is butyl N-(tert-butylsulfanylcarbamoyl)-N-(prop-2-enylcarbamoyl)carbamimidate.
| Compound Name | butyl N-(tert-butylsulfanylcarbamoyl)-N-(prop-2-enylcarbamoyl)carbamimidate |
|---|---|
| PubChem CID | 21442020 |
| Molecular Formula | C14H26N4O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | butyl N-(tert-butylsulfanylcarbamoyl)-N-(prop-2-enylcarbamoyl)carbamimidate |
| SMILES | [H]/N=C(\OCCCC)N(C(=O)NCC=C)C(=O)NSC(C)(C)C |
| InChI | InChI=1S/C14H26N4O3S/c1-6-8-10-21-11(15)18(12(19)16-9-7-2)13(20)17-22-14(3,4)5/h7,15H,2,6,8-10H2,1,3-5H3,(H,16,19)(H,17,20)/b15-11- |
| InChIKey | ZTIYGOPQSGYJPK-PTNGSMBKSA-N |
| XLogP | 3.09 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|