C22H38O5 — CID 21450495
2-[8-[(E)-3-hydroxyoct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid (PubChem CID 21450495) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 2-[8-[(E)-3-hydroxyoct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid.
| Compound Name | 2-[8-[(E)-3-hydroxyoct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
|---|---|
| PubChem CID | 21450495 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 2-[8-[(E)-3-hydroxyoct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
| SMILES | CCCCCC(O)/C=C/C1CCC2(OCCO2)C1C(CCCCC)C(=O)O |
| InChI | InChI=1S/C22H38O5/c1-3-5-7-9-18(23)12-11-17-13-14-22(26-15-16-27-22)20(17)19(21(24)25)10-8-6-4-2/h11-12,17-20,23H,3-10,13-16H2,1-2H3,(H,24,25)/b12-11+ |
| InChIKey | RSQSULHRRFCMSE-VAWYXSNFSA-N |
| XLogP | 4.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|