C13H12N4O7 — CID 21453109
2-[(3-formyl-2-oxoimidazolidine-1-carbonyl)amino]-2-(4-nitrophenyl)acetic acid (PubChem CID 21453109) has the molecular formula C13H12N4O7 and a molecular weight of 336.26 g/mol. Its IUPAC name is 2-[(3-formyl-2-oxoimidazolidine-1-carbonyl)amino]-2-(4-nitrophenyl)acetic acid.
| Compound Name | 2-[(3-formyl-2-oxoimidazolidine-1-carbonyl)amino]-2-(4-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 21453109 |
| Molecular Formula | C13H12N4O7 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[(3-formyl-2-oxoimidazolidine-1-carbonyl)amino]-2-(4-nitrophenyl)acetic acid |
| SMILES | O=CN1CCN(C(=O)NC(C(=O)O)c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C13H12N4O7/c18-7-15-5-6-16(13(15)22)12(21)14-10(11(19)20)8-1-3-9(4-2-8)17(23)24/h1-4,7,10H,5-6H2,(H,14,21)(H,19,20) |
| InChIKey | QVVRFFQORBGGTC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|