About Methyl-Phenyl-Disilane
Methyl-Phenyl-Disilane (PubChem CID 21461685) has the molecular formula C7H8Si2
and a molecular weight of 148.31 g/mol.
Molecular Properties
| Compound Name | Methyl-Phenyl-Disilane |
| PubChem CID | 21461685 |
| Molecular Formula | C7H8Si2 |
| Molecular Weight | 148.31 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | — |
| SMILES | C[Si]([Si])c1ccccc1 |
| InChI | InChI=1S/C7H8Si2/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | PFOQOLNAQXZWRE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Methyl-Phenyl-Disilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl-Phenyl-Disilane?
The IUPAC name of Methyl-Phenyl-Disilane (CID 21461685) is not available.
What is the SMILES notation for Methyl-Phenyl-Disilane?
The canonical SMILES for Methyl-Phenyl-Disilane is C[Si]([Si])c1ccccc1.
What is the InChIKey of Methyl-Phenyl-Disilane?
The InChIKey is PFOQOLNAQXZWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Si2/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of Methyl-Phenyl-Disilane?
Methyl-Phenyl-Disilane has a molecular weight of 148.31 g/mol, XLogP of 0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl-Phenyl-Disilane is sourced from PubChem (CID 21461685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).