About CID 21461617
CID 21461617 (PubChem CID 21461617) has the molecular formula C10H14Si3
and a molecular weight of 218.48 g/mol.
Molecular Properties
| Compound Name | CID 21461617 |
| PubChem CID | 21461617 |
| Molecular Formula | C10H14Si3 |
| Molecular Weight | 218.48 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si][Si]([Si])c1ccccc1 |
| InChI | InChI=1S/C10H14Si3/c1-10(2,3)12-13(11)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | WWYANOGYAIRZSK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21461617 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21461617?
The IUPAC name of CID 21461617 (CID 21461617) is not available.
What is the SMILES notation for CID 21461617?
The canonical SMILES for CID 21461617 is CC(C)(C)[Si][Si]([Si])c1ccccc1.
What is the InChIKey of CID 21461617?
The InChIKey is WWYANOGYAIRZSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Si3/c1-10(2,3)12-13(11)9-7-5-4-6-8-9/h4-8H,1-3H3.
What are the key properties of CID 21461617?
CID 21461617 has a molecular weight of 218.48 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21461617 is sourced from PubChem (CID 21461617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).