C14H19ClO11P2 — CID 21464966
2-[2-(5-chloro-2-methoxyphenyl)ethyl]-2,4-diphosphonopentanedioic acid (PubChem CID 21464966) has the molecular formula C14H19ClO11P2 and a molecular weight of 460.70 g/mol. Its IUPAC name is 2-[2-(5-chloro-2-methoxyphenyl)ethyl]-2,4-diphosphonopentanedioic acid.
| Compound Name | 2-[2-(5-chloro-2-methoxyphenyl)ethyl]-2,4-diphosphonopentanedioic acid |
|---|---|
| PubChem CID | 21464966 |
| Molecular Formula | C14H19ClO11P2 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 2-[2-(5-chloro-2-methoxyphenyl)ethyl]-2,4-diphosphonopentanedioic acid |
| SMILES | COc1ccc(Cl)cc1CCC(CC(C(=O)O)P(=O)(O)O)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C14H19ClO11P2/c1-26-10-3-2-9(15)6-8(10)4-5-14(13(18)19,28(23,24)25)7-11(12(16)17)27(20,21)22/h2-3,6,11H,4-5,7H2,1H3,(H,16,17)(H,18,19)(H2,20,21,22)(H2,23,24,25) |
| InChIKey | AMOFUYYCLUPPAR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|