C20H18Br2O3 — CID 21466251
1-(3,3-dibromoprop-2-enoxy)-2-ethynyl-4-(4-propan-2-yloxyphenoxy)benzene (PubChem CID 21466251) has the molecular formula C20H18Br2O3 and a molecular weight of 466.17 g/mol. Its IUPAC name is 1-(3,3-dibromoprop-2-enoxy)-2-ethynyl-4-(4-propan-2-yloxyphenoxy)benzene.
| Compound Name | 1-(3,3-dibromoprop-2-enoxy)-2-ethynyl-4-(4-propan-2-yloxyphenoxy)benzene |
|---|---|
| PubChem CID | 21466251 |
| Molecular Formula | C20H18Br2O3 |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | 1-(3,3-dibromoprop-2-enoxy)-2-ethynyl-4-(4-propan-2-yloxyphenoxy)benzene |
| SMILES | C#Cc1cc(Oc2ccc(OC(C)C)cc2)ccc1OCC=C(Br)Br |
| InChI | InChI=1S/C20H18Br2O3/c1-4-15-13-18(9-10-19(15)23-12-11-20(21)22)25-17-7-5-16(6-8-17)24-14(2)3/h1,5-11,13-14H,12H2,2-3H3 |
| InChIKey | LDSCQDQWQPHQJW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|